共 50 条
- [2] Ferrocenyl-substituted imine ligands and their reactivity towards Fe2(CO)9;: crystal structure of Fc-C(H)=C(H)-C(H)=N-C6H11 and (η4-R1-C(H)=C(H)-C(H)=N-R2)Fe(CO)3 (R1 = C6H5, R2 = Fc; R1 = Fc, R2 = C6H11, R1 = R2 = Fc; Fc = (η5-C5H5)Fe(η5-C5H4)) INORGANICA CHIMICA ACTA, 1998, 282 (01) : 111 - 118
- [5] Thermochemistry of 4-HOC6H4COR (R = H, CH3, C2H5, n-C3H7, n-C4H9, n-C5H11, and n-C6H13) compounds JOURNAL OF CHEMICAL THERMODYNAMICS, 2017, 104 : 281 - 287