Synthesis and crystal structure of ternary complex Cu(C10H8N2O3) • (C5H5N) • (H2O)

The novel copper(II) complex with 2-oxo-propionic acid benzoyl hydrazone and pyridine ligands, Cu(C10H8N2O3).(C5H5N).(H2O) (C10H8N2O32- is the dinegative ion of 2-oxo-propionicacid benzoyl hydrazone), has been synthesized and characterized by elemental analysis and IR. The crystal structure of the title complex was determined by single crystal X-ray diffraction technique. Complex crystallized in the triclinic space group P1 with a = 0.729 08(10) nm, b = 1.020 01(14) nm, c = 1.126 28(15) nm, alpha = 71.644(2) degrees, beta = 80.437(2) degrees, gamma = 89.160 (2)degrees, V = 0.783 28(18) nm(3), Z = 2, D-c = 1.547 Mg(.)m(-3), mu(MoKalpha) = 1.417 mm(-1), F(000) = 374. The final R-1 = 0.030 6, wR(2) = 0.084 2 for 2 992 observed reflections [Igreater than or equal to2sigma(I)] out of 3 357 unique reflections. In this complex, copper(II) ion is square-pyramidally coordinated by two oxygen atoms and one nitrogen atom of tridentate C(10)H(8)N(2)O(3)2- ligand, one nitrogen atom of the pyridine ligand, and one oxygen atom of water molecule with the oxygen atom of water molecule locating at the apical position. The analysis of the crystal structure indicates that the complex has a one-dimensional chain structure, which is formed by intermolecular hydrogen bonds.