Characterization and Crystal Structure of Bis(N'-ethyl-N-piperazinly-carbodithioato-S,S') Nickel(II) Complex:Ni(S2CNC4H8NC2H5)2

The title compound has been prepared and characterized by elemental analysis, infrared and FT-Raman spectra, and thermal analysis. The crystal and molecular structures of bis(N?-ethyl-N-piperazinly-carbodithioato-S,S) nickel(II) complex (Ni(S2CNC4H8NC2H5)2) were determined by X-ray diffraction methods. The crystal crystallizes in the triclinic system, space group P1 with a = 0.66770(15), b = 0.85066(12), c = 0.8973(2) nm, α = 84.97(2), β =78.71(2), γ = 80.12(2)°, Mr = 437.34, V = 0.49160(17) nm3, Z = 1, Dc = 1.477 g/cm3, F(000) = 230, R = 0.0422 and wR = 0.1290. In the structure, the central Ni atom is coordinated in a slightly distorted square plane by four S atoms from two bidentate S2CNC4H8NC2H5 ligands with the four Ni–S bond distances in the range of 0.22065(10)～0.22076(9) nm. The IR and FT-Raman spectral data are in agreement with the structural data. Thermal analysis indicates that the title compound decomposes completely at the temperature of 799.88 ℃, leaving NiS.